C30H38Cl2N4O4 — CID 159154531
ethyl (4R)-4-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-7-(5,6-dichloro-2-pyridinyl)-5-oxoheptanoate (PubChem CID 159154531) has the molecular formula C30H38Cl2N4O4 and a molecular weight of 589.56 g/mol. Its IUPAC name is ethyl (4R)-4-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-7-(5,6-dichloro-2-pyridinyl)-5-oxoheptanoate.
| Compound Name | ethyl (4R)-4-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-7-(5,6-dichloro-2-pyridinyl)-5-oxoheptanoate |
|---|---|
| PubChem CID | 159154531 |
| Molecular Formula | C30H38Cl2N4O4 |
| Molecular Weight | 589.56 g/mol |
| Exact Mass | 588.23 |
| IUPAC Name | ethyl (4R)-4-[(8R,9aS)-8-amino-1-oxo-5-(2-phenylethyl)-4,5,7,8,9,9a-hexahydro-3H-pyrrolo[1,2-a][1,4]diazepin-2-yl]-7-(5,6-dichloro-2-pyridinyl)-5-oxoheptanoate |
| SMILES | CCOC(=O)CC[C@H](C(=O)CCc1ccc(Cl)c(Cl)n1)N1CCC(CCc2ccccc2)N2C[C@H](N)C[C@H]2C1=O |
| InChI | InChI=1S/C30H38Cl2N4O4/c1-2-40-28(38)15-13-25(27(37)14-10-22-9-12-24(31)29(32)34-22)35-17-16-23(11-8-20-6-4-3-5-7-20)36-19-21(33)18-26(36)30(35)39/h3-7,9,12,21,23,25-26H,2,8,10-11,13-19,33H2,1H3/t21-,23?,25-,26+/m1/s1 |
| InChIKey | JVSBAKWKRQWETM-KNHRJBGOSA-N |
| XLogP | 4.24 |
| TPSA | 105.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.56 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|