C17H21N3O4S — CID 159154711
1-[(Z)-5-[(2R)-2-phenylpropyl]sulfonylpent-2-enyl]-1,3,5-triazine-2,4-dione (PubChem CID 159154711) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is 1-[(Z)-5-[(2R)-2-phenylpropyl]sulfonylpent-2-enyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 1-[(Z)-5-[(2R)-2-phenylpropyl]sulfonylpent-2-enyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 159154711 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-[(Z)-5-[(2R)-2-phenylpropyl]sulfonylpent-2-enyl]-1,3,5-triazine-2,4-dione |
| SMILES | C[C@@H](CS(=O)(=O)CC/C=C\Cn1cnc(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C17H21N3O4S/c1-14(15-8-4-2-5-9-15)12-25(23,24)11-7-3-6-10-20-13-18-16(21)19-17(20)22/h2-6,8-9,13-14H,7,10-12H2,1H3,(H,19,21,22)/b6-3-/t14-/m0/s1 |
| InChIKey | KJSWBBXWDVLZJR-XSHSDMCLSA-N |
| XLogP | 1.10 |
| TPSA | 101.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|