C19H28AcN5O3S- — CID 159154836
actinium;(2S,4R)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide;molecular hydrogen (PubChem CID 159154836) has the molecular formula C19H28AcN5O3S- and a molecular weight of 633.53 g/mol. Its IUPAC name is actinium;(2S,4R)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide;molecular hydrogen.
| Compound Name | actinium;(2S,4R)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159154836 |
| Molecular Formula | C19H28AcN5O3S- |
| Molecular Weight | 633.53 g/mol |
| Exact Mass | 633.22 |
| IUPAC Name | actinium;(2S,4R)-N-[(2S)-5-(1-aminoethylideneamino)-1-(1,3-benzothiazol-2-yl)-1-hydroxypentan-2-yl]-4-hydroxypyrrolidin-1-ide-2-carboxamide;molecular hydrogen |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)[C@@H]1C[C@@H](O)C[N-]1)C(O)c1nc2ccccc2s1.[Ac].[H][H] |
| InChI | InChI=1S/C19H26N5O3S.Ac.H2/c1-11(20)21-8-4-6-14(23-18(27)15-9-12(25)10-22-15)17(26)19-24-13-5-2-3-7-16(13)28-19;;/h2-3,5,7,12,14-15,17,25-26H,4,6,8-10H2,1H3,(H2,20,21)(H,23,27);;1H/q-1;;/t12-,14+,15+,17?;;/m1../s1 |
| InChIKey | DMYUKJGHLFQAIP-GUFCABLTSA-N |
| XLogP | 1.72 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|