About hydron;ruthenium;hexafluorophosphate
hydron;ruthenium;hexafluorophosphate (PubChem CID 159154878) has the molecular formula HF6PRu
and a molecular weight of 247.04 g/mol. Its IUPAC name is hydron;ruthenium;hexafluorophosphate.
Molecular Properties
| Compound Name | hydron;ruthenium;hexafluorophosphate |
| PubChem CID | 159154878 |
| Molecular Formula | HF6PRu |
| Molecular Weight | 247.04 g/mol |
| Exact Mass | 247.88 |
| IUPAC Name | hydron;ruthenium;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.[H+].[Ru] |
| InChI | InChI=1S/F6P.Ru/c1-7(2,3,4,5)6;/q-1;/p+1 |
| InChIKey | BLJJHXAGHHOLGF-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.04 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydron;ruthenium;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;ruthenium;hexafluorophosphate?
The IUPAC name of hydron;ruthenium;hexafluorophosphate (CID 159154878) is hydron;ruthenium;hexafluorophosphate.
What is the SMILES notation for hydron;ruthenium;hexafluorophosphate?
The canonical SMILES for hydron;ruthenium;hexafluorophosphate is F[P-](F)(F)(F)(F)F.[H+].[Ru].
What is the InChIKey of hydron;ruthenium;hexafluorophosphate?
The InChIKey is BLJJHXAGHHOLGF-UHFFFAOYSA-O. The full InChI is InChI=1S/F6P.Ru/c1-7(2,3,4,5)6;/q-1;/p+1.
What are the key properties of hydron;ruthenium;hexafluorophosphate?
hydron;ruthenium;hexafluorophosphate has a molecular weight of 247.04 g/mol, XLogP of 3.49, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;ruthenium;hexafluorophosphate is sourced from PubChem (CID 159154878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).