About 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate
1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate (PubChem CID 159155492) has the molecular formula C15H15F2NO5
and a molecular weight of 327.28 g/mol. Its IUPAC name is 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate.
Molecular Properties
| Compound Name | 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate |
| PubChem CID | 159155492 |
| Molecular Formula | C15H15F2NO5 |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate |
| SMILES | C.COC(=O)c1c(O)cccc1F.O=[N+]([O-])c1ccccc1F |
| InChI | InChI=1S/C8H7FO3.C6H4FNO2.CH4/c1-12-8(11)7-5(9)3-2-4-6(7)10;7-5-3-1-2-4-6(5)8(9)10;/h2-4,10H,1H3;1-4H;1H4 |
| InChIKey | KJVKXHQJZLINAQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate?
The IUPAC name of 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate (CID 159155492) is 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate.
What is the SMILES notation for 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate?
The canonical SMILES for 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate is C.COC(=O)c1c(O)cccc1F.O=[N+]([O-])c1ccccc1F.
What is the InChIKey of 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate?
The InChIKey is KJVKXHQJZLINAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7FO3.C6H4FNO2.CH4/c1-12-8(11)7-5(9)3-2-4-6(7)10;7-5-3-1-2-4-6(5)8(9)10;/h2-4,10H,1H3;1-4H;1H4.
What are the key properties of 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate?
1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate has a molecular weight of 327.28 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-nitrobenzene;methane;methyl 2-fluoro-6-hydroxybenzoate is sourced from PubChem (CID 159155492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).