C8H10N4O3 — CID 159156553
piperazine-2,3-dione;1H-pyridazin-6-one (PubChem CID 159156553) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is piperazine-2,3-dione;1H-pyridazin-6-one.
| Compound Name | piperazine-2,3-dione;1H-pyridazin-6-one |
|---|---|
| PubChem CID | 159156553 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | piperazine-2,3-dione;1H-pyridazin-6-one |
| SMILES | O=C1NCCNC1=O.O=c1cccn[nH]1 |
| InChI | InChI=1S/C4H6N2O2.C4H4N2O/c7-3-4(8)6-2-1-5-3;7-4-2-1-3-5-6-4/h1-2H2,(H,5,7)(H,6,8);1-3H,(H,6,7) |
| InChIKey | KJYRWANMQRWQQV-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|