C43H47F5O6S3 — CID 159157264
difluoro-(2,4,6-tricyclohexylphenoxy)sulfonylmethanesulfonate;tris(4-fluorophenyl)sulfanium (PubChem CID 159157264) has the molecular formula C43H47F5O6S3 and a molecular weight of 851.03 g/mol. Its IUPAC name is difluoro-(2,4,6-tricyclohexylphenoxy)sulfonylmethanesulfonate;tris(4-fluorophenyl)sulfanium.
| Compound Name | difluoro-(2,4,6-tricyclohexylphenoxy)sulfonylmethanesulfonate;tris(4-fluorophenyl)sulfanium |
|---|---|
| PubChem CID | 159157264 |
| Molecular Formula | C43H47F5O6S3 |
| Molecular Weight | 851.03 g/mol |
| Exact Mass | 850.25 |
| IUPAC Name | difluoro-(2,4,6-tricyclohexylphenoxy)sulfonylmethanesulfonate;tris(4-fluorophenyl)sulfanium |
| SMILES | Fc1ccc([S+](c2ccc(F)cc2)c2ccc(F)cc2)cc1.O=S(=O)([O-])C(F)(F)S(=O)(=O)Oc1c(C2CCCCC2)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C25H36F2O6S2.C18H12F3S/c26-25(27,34(28,29)30)35(31,32)33-24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(24)20-14-8-3-9-15-20;19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18/h16-20H,1-15H2,(H,28,29,30);1-12H/q;+1/p-1 |
| InChIKey | KKAWCJKBEJXYIM-UHFFFAOYSA-M |
| XLogP | 11.83 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.03 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|