About 1-aminocyclohexa-2,4-dien-1-ol;piperazine
1-aminocyclohexa-2,4-dien-1-ol;piperazine (PubChem CID 159158069) has the molecular formula C10H19N3O
and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-aminocyclohexa-2,4-dien-1-ol;piperazine.
Molecular Properties
| Compound Name | 1-aminocyclohexa-2,4-dien-1-ol;piperazine |
| PubChem CID | 159158069 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1-aminocyclohexa-2,4-dien-1-ol;piperazine |
| SMILES | C1CNCCN1.NC1(O)C=CC=CC1 |
| InChI | InChI=1S/C6H9NO.C4H10N2/c7-6(8)4-2-1-3-5-6;1-2-6-4-3-5-1/h1-4,8H,5,7H2;5-6H,1-4H2 |
| InChIKey | KKDHMVRYBTYNJC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminocyclohexa-2,4-dien-1-ol;piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminocyclohexa-2,4-dien-1-ol;piperazine?
The IUPAC name of 1-aminocyclohexa-2,4-dien-1-ol;piperazine (CID 159158069) is 1-aminocyclohexa-2,4-dien-1-ol;piperazine.
What is the SMILES notation for 1-aminocyclohexa-2,4-dien-1-ol;piperazine?
The canonical SMILES for 1-aminocyclohexa-2,4-dien-1-ol;piperazine is C1CNCCN1.NC1(O)C=CC=CC1.
What is the InChIKey of 1-aminocyclohexa-2,4-dien-1-ol;piperazine?
The InChIKey is KKDHMVRYBTYNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO.C4H10N2/c7-6(8)4-2-1-3-5-6;1-2-6-4-3-5-1/h1-4,8H,5,7H2;5-6H,1-4H2.
What are the key properties of 1-aminocyclohexa-2,4-dien-1-ol;piperazine?
1-aminocyclohexa-2,4-dien-1-ol;piperazine has a molecular weight of 197.28 g/mol, XLogP of -0.67, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminocyclohexa-2,4-dien-1-ol;piperazine is sourced from PubChem (CID 159158069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).