C16H25FI2N8O5S2 — CID 159158729
3-[[(2R)-3-amino-2-hydroxypropyl]sulfamoyl]-6-[(3R,4S)-4-(aminomethyl)-3-fluoropiperidin-1-yl]-N'-iodo-N-iodoimino-2-sulfamoylbenzenecarboximidamide (PubChem CID 159158729) has the molecular formula C16H25FI2N8O5S2 and a molecular weight of 746.37 g/mol. Its IUPAC name is 3-[[(2R)-3-amino-2-hydroxypropyl]sulfamoyl]-6-[(3R,4S)-4-(aminomethyl)-3-fluoropiperidin-1-yl]-N'-iodo-N-iodoimino-2-sulfamoylbenzenecarboximidamide.
| Compound Name | 3-[[(2R)-3-amino-2-hydroxypropyl]sulfamoyl]-6-[(3R,4S)-4-(aminomethyl)-3-fluoropiperidin-1-yl]-N'-iodo-N-iodoimino-2-sulfamoylbenzenecarboximidamide |
|---|---|
| PubChem CID | 159158729 |
| Molecular Formula | C16H25FI2N8O5S2 |
| Molecular Weight | 746.37 g/mol |
| Exact Mass | 745.95 |
| IUPAC Name | 3-[[(2R)-3-amino-2-hydroxypropyl]sulfamoyl]-6-[(3R,4S)-4-(aminomethyl)-3-fluoropiperidin-1-yl]-N'-iodo-N-iodoimino-2-sulfamoylbenzenecarboximidamide |
| SMILES | NC[C@@H](O)CNS(=O)(=O)c1ccc(N2CC[C@@H](CN)[C@@H](F)C2)c(C(=NI)/N=N/I)c1S(N)(=O)=O |
| InChI | InChI=1S/C16H25FI2N8O5S2/c17-11-8-27(4-3-9(11)5-20)12-1-2-13(34(31,32)23-7-10(28)6-21)15(33(22,29)30)14(12)16(24-18)25-26-19/h1-2,9-11,23,28H,3-8,20-21H2,(H2,22,29,30)/b24-16?,26-25+/t9-,10+,11-/m0/s1 |
| InChIKey | KKFMTFPGBOHLCE-ZBSMSZPKSA-N |
| XLogP | -0.05 |
| TPSA | 218.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.37 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|