C25H34N2O5S — CID 159159891
2,6-ditert-butyl-4-[2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepin-2-yl)ethenyl]phenol;oxalic acid (PubChem CID 159159891) has the molecular formula C25H34N2O5S and a molecular weight of 474.62 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepin-2-yl)ethenyl]phenol;oxalic acid.
| Compound Name | 2,6-ditert-butyl-4-[2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepin-2-yl)ethenyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 159159891 |
| Molecular Formula | C25H34N2O5S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-(5,6,7,8-tetrahydro-4H-[1,3]thiazolo[5,4-b]azepin-2-yl)ethenyl]phenol;oxalic acid |
| SMILES | CC(C)(C)c1cc(C=Cc2nc3c(s2)NCCCC3)cc(C(C)(C)C)c1O.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H32N2OS.C2H2O4/c1-22(2,3)16-13-15(14-17(20(16)26)23(4,5)6)10-11-19-25-18-9-7-8-12-24-21(18)27-19;3-1(4)2(5)6/h10-11,13-14,24,26H,7-9,12H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | KKIXGLUMZGQOSX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|