About 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea
1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea (PubChem CID 159160491) has the molecular formula C10H22N4O6
and a molecular weight of 294.31 g/mol. Its IUPAC name is 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea.
Molecular Properties
| Compound Name | 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea |
| PubChem CID | 159160491 |
| Molecular Formula | C10H22N4O6 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea |
| SMILES | NC(N)=O.O=C1N(CO)CCN1CO.OCC=CCO |
| InChI | InChI=1S/C5H10N2O3.C4H8O2.CH4N2O/c8-3-6-1-2-7(4-9)5(6)10;5-3-1-2-4-6;2-1(3)4/h8-9H,1-4H2;1-2,5-6H,3-4H2;(H4,2,3,4) |
| InChIKey | KKKRXZCBFTZSHM-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 173.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea?
The IUPAC name of 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea (CID 159160491) is 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea.
What is the SMILES notation for 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea?
The canonical SMILES for 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea is NC(N)=O.O=C1N(CO)CCN1CO.OCC=CCO.
What is the InChIKey of 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea?
The InChIKey is KKKRXZCBFTZSHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O3.C4H8O2.CH4N2O/c8-3-6-1-2-7(4-9)5(6)10;5-3-1-2-4-6;2-1(3)4/h8-9H,1-4H2;1-2,5-6H,3-4H2;(H4,2,3,4).
What are the key properties of 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea?
1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea has a molecular weight of 294.31 g/mol, XLogP of -2.83, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(hydroxymethyl)imidazolidin-2-one;but-2-ene-1,4-diol;urea is sourced from PubChem (CID 159160491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).