C4Cl3F5O — CID 15916237
1,1,1-trichloro-3,3,4,4,4-pentafluorobutan-2-one (PubChem CID 15916237) has the molecular formula C4Cl3F5O and a molecular weight of 265.39 g/mol. Its IUPAC name is 1,1,1-trichloro-3,3,4,4,4-pentafluorobutan-2-one.
| Compound Name | 1,1,1-trichloro-3,3,4,4,4-pentafluorobutan-2-one |
|---|---|
| PubChem CID | 15916237 |
| Molecular Formula | C4Cl3F5O |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 263.89 |
| IUPAC Name | 1,1,1-trichloro-3,3,4,4,4-pentafluorobutan-2-one |
| SMILES | O=C(C(Cl)(Cl)Cl)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C4Cl3F5O/c5-3(6,7)1(13)2(8,9)4(10,11)12 |
| InChIKey | XPPFGNMHXZHSNL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|