C6ClF11O — CID 15916238
1-chloro-1,1,3,3,4,4,5,5,6,6,6-undecafluorohexan-2-one (PubChem CID 15916238) has the molecular formula C6ClF11O and a molecular weight of 332.50 g/mol. Its IUPAC name is 1-chloro-1,1,3,3,4,4,5,5,6,6,6-undecafluorohexan-2-one.
| Compound Name | 1-chloro-1,1,3,3,4,4,5,5,6,6,6-undecafluorohexan-2-one |
|---|---|
| PubChem CID | 15916238 |
| Molecular Formula | C6ClF11O |
| Molecular Weight | 332.50 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 1-chloro-1,1,3,3,4,4,5,5,6,6,6-undecafluorohexan-2-one |
| SMILES | O=C(C(F)(F)Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6ClF11O/c7-3(10,11)1(19)2(8,9)4(12,13)5(14,15)6(16,17)18 |
| InChIKey | NVNUWRJQLBIQAX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|