About 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline
3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline (PubChem CID 159162864) has the molecular formula C23H23NO4
and a molecular weight of 377.44 g/mol. Its IUPAC name is 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline.
Molecular Properties
| Compound Name | 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline |
| PubChem CID | 159162864 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline |
| SMILES | O=C1OC(CCCCc2ccccc2)C(O)=C1O.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H16O4.C9H7N/c15-12-11(18-14(17)13(12)16)9-5-4-8-10-6-2-1-3-7-10;1-2-6-9-8(4-1)5-3-7-10-9/h1-3,6-7,11,15-16H,4-5,8-9H2;1-7H |
| InChIKey | KKSGLNUANAHJGS-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline?
The IUPAC name of 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline (CID 159162864) is 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline.
What is the SMILES notation for 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline?
The canonical SMILES for 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline is O=C1OC(CCCCc2ccccc2)C(O)=C1O.c1ccc2ncccc2c1.
What is the InChIKey of 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline?
The InChIKey is KKSGLNUANAHJGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O4.C9H7N/c15-12-11(18-14(17)13(12)16)9-5-4-8-10-6-2-1-3-7-10;1-2-6-9-8(4-1)5-3-7-10-9/h1-3,6-7,11,15-16H,4-5,8-9H2;1-7H.
What are the key properties of 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline?
3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline has a molecular weight of 377.44 g/mol, XLogP of 4.89, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-2-(4-phenylbutyl)-2H-furan-5-one;quinoline is sourced from PubChem (CID 159162864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).