About 1-fluorohept-6-yne-2,5-diamine
1-fluorohept-6-yne-2,5-diamine (PubChem CID 15916371) has the molecular formula C7H13FN2
and a molecular weight of 144.19 g/mol. Its IUPAC name is 1-fluorohept-6-yne-2,5-diamine.
Molecular Properties
| Compound Name | 1-fluorohept-6-yne-2,5-diamine |
| PubChem CID | 15916371 |
| Molecular Formula | C7H13FN2 |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.11 |
| IUPAC Name | 1-fluorohept-6-yne-2,5-diamine |
| SMILES | C#CC(N)CCC(N)CF |
| InChI | InChI=1S/C7H13FN2/c1-2-6(9)3-4-7(10)5-8/h1,6-7H,3-5,9-10H2 |
| InChIKey | IZGRRHBQGZGDQH-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluorohept-6-yne-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluorohept-6-yne-2,5-diamine?
The IUPAC name of 1-fluorohept-6-yne-2,5-diamine (CID 15916371) is 1-fluorohept-6-yne-2,5-diamine.
What is the SMILES notation for 1-fluorohept-6-yne-2,5-diamine?
The canonical SMILES for 1-fluorohept-6-yne-2,5-diamine is C#CC(N)CCC(N)CF.
What is the InChIKey of 1-fluorohept-6-yne-2,5-diamine?
The InChIKey is IZGRRHBQGZGDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FN2/c1-2-6(9)3-4-7(10)5-8/h1,6-7H,3-5,9-10H2.
What are the key properties of 1-fluorohept-6-yne-2,5-diamine?
1-fluorohept-6-yne-2,5-diamine has a molecular weight of 144.19 g/mol, XLogP of 0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluorohept-6-yne-2,5-diamine is sourced from PubChem (CID 15916371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).