C31H33IN6 — CID 159164122
3-phenyl-1-propan-2-ylimidazo[4,5-b]pyridin-1-ium;8-propan-2-yl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene;iodide (PubChem CID 159164122) has the molecular formula C31H33IN6 and a molecular weight of 616.55 g/mol. Its IUPAC name is 3-phenyl-1-propan-2-ylimidazo[4,5-b]pyridin-1-ium;8-propan-2-yl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene;iodide.
| Compound Name | 3-phenyl-1-propan-2-ylimidazo[4,5-b]pyridin-1-ium;8-propan-2-yl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene;iodide |
|---|---|
| PubChem CID | 159164122 |
| Molecular Formula | C31H33IN6 |
| Molecular Weight | 616.55 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | 3-phenyl-1-propan-2-ylimidazo[4,5-b]pyridin-1-ium;8-propan-2-yl-1,3,8-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene;iodide |
| SMILES | CC(C)N1c2cccnc2N2c3ccccc3CC21.CC(C)[n+]1cn(-c2ccccc2)c2ncccc21.[I-] |
| InChI | InChI=1S/C16H17N3.C15H16N3.HI/c1-11(2)18-14-8-5-9-17-16(14)19-13-7-4-3-6-12(13)10-15(18)19;1-12(2)17-11-18(13-7-4-3-5-8-13)15-14(17)9-6-10-16-15;/h3-9,11,15H,10H2,1-2H3;3-12H,1-2H3;1H/q;+1;/p-1 |
| InChIKey | ZOOGXTYVGYPLNE-UHFFFAOYSA-M |
| XLogP | 3.23 |
| TPSA | 41.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|