About 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride
2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride (PubChem CID 159164139) has the molecular formula C25H31Cl2N3O2
and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride.
Molecular Properties
| Compound Name | 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride |
| PubChem CID | 159164139 |
| Molecular Formula | C25H31Cl2N3O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride |
| SMILES | Cc1ccc2ccc(Cl)nc2c1.Cl.c1cnc(OC2CCNCC2)c(C2CCOCC2)c1 |
| InChI | InChI=1S/C15H22N2O2.C10H8ClN.ClH/c1-2-14(12-5-10-18-11-6-12)15(17-7-1)19-13-3-8-16-9-4-13;1-7-2-3-8-4-5-10(11)12-9(8)6-7;/h1-2,7,12-13,16H,3-6,8-11H2;2-6H,1H3;1H |
| InChIKey | UOVKVOMAZMPWEJ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride?
The IUPAC name of 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride (CID 159164139) is 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride.
What is the SMILES notation for 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride?
The canonical SMILES for 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride is Cc1ccc2ccc(Cl)nc2c1.Cl.c1cnc(OC2CCNCC2)c(C2CCOCC2)c1.
What is the InChIKey of 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride?
The InChIKey is UOVKVOMAZMPWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N2O2.C10H8ClN.ClH/c1-2-14(12-5-10-18-11-6-12)15(17-7-1)19-13-3-8-16-9-4-13;1-7-2-3-8-4-5-10(11)12-9(8)6-7;/h1-2,7,12-13,16H,3-6,8-11H2;2-6H,1H3;1H.
What are the key properties of 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride?
2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride has a molecular weight of 476.45 g/mol, XLogP of 5.72, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7-methylquinoline;3-(oxan-4-yl)-2-piperidin-4-yloxypyridine;hydrochloride is sourced from PubChem (CID 159164139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).