C19H24O3 — CID 159164812
cyclohexa-1,3-diene;4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one (PubChem CID 159164812) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is cyclohexa-1,3-diene;4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one.
| Compound Name | cyclohexa-1,3-diene;4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one |
|---|---|
| PubChem CID | 159164812 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | cyclohexa-1,3-diene;4-ethyl-5-hydroxy-3-oxatricyclo[6.2.2.02,7]dodeca-4,9-dien-6-one |
| SMILES | C1=CCCC=C1.CCC1=C(O)C(=O)C2C3C=CC(CC3)C2O1 |
| InChI | InChI=1S/C13H16O3.C6H8/c1-2-9-11(14)12(15)10-7-3-5-8(6-4-7)13(10)16-9;1-2-4-6-5-3-1/h3,5,7-8,10,13-14H,2,4,6H2,1H3;1-4H,5-6H2 |
| InChIKey | KKXZQUSQASVOEO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|