C25H27F3O6S3 — CID 159166060
tribenzylsulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate (PubChem CID 159166060) has the molecular formula C25H27F3O6S3 and a molecular weight of 576.68 g/mol. Its IUPAC name is tribenzylsulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate.
| Compound Name | tribenzylsulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate |
|---|---|
| PubChem CID | 159166060 |
| Molecular Formula | C25H27F3O6S3 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.09 |
| IUPAC Name | tribenzylsulfanium;1,1,2-trifluoro-3-methylsulfonyloxypropane-1-sulfonate |
| SMILES | CS(=O)(=O)OCC(F)C(F)(F)S(=O)(=O)[O-].c1ccc(C[S+](Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21S.C4H7F3O6S2/c1-4-10-19(11-5-1)16-22(17-20-12-6-2-7-13-20)18-21-14-8-3-9-15-21;1-14(8,9)13-2-3(5)4(6,7)15(10,11)12/h1-15H,16-18H2;3H,2H2,1H3,(H,10,11,12)/q+1;/p-1 |
| InChIKey | KLBWYBAKWWNIRA-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 100.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|