C24H21Cl2F6N3O2 — CID 159166121
(10R,14R)-N-(3,4-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-7-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 159166121) has the molecular formula C24H21Cl2F6N3O2 and a molecular weight of 568.35 g/mol. Its IUPAC name is (10R,14R)-N-(3,4-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-7-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | (10R,14R)-N-(3,4-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-7-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 159166121 |
| Molecular Formula | C24H21Cl2F6N3O2 |
| Molecular Weight | 568.35 g/mol |
| Exact Mass | 567.09 |
| IUPAC Name | (10R,14R)-N-(3,4-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-trien-7-amine;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | Clc1ccc(Nc2cc3c4c(c2)[C@@H]2CNC[C@@H]2CN4CCC3)cc1Cl.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H21Cl2N3.C4F6O2/c21-18-4-3-14(8-19(18)22)24-15-6-12-2-1-5-25-11-13-9-23-10-17(13)16(7-15)20(12)25;5-3(6,7)1(11)2(12)4(8,9)10/h3-4,6-8,13,17,23-24H,1-2,5,9-11H2;/t13-,17-;/m1./s1 |
| InChIKey | KLCARZXMVNNOAU-UFIUYGHPSA-N |
| XLogP | 6.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.35 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|