C29H36ClF2N7O3 — CID 159166738
(2E)-3-amino-N-[1-amino-1-[5-chloro-2-(difluoromethoxy)phenyl]-3-[1-(5-oxohexyl)piperidin-4-yl]iminoprop-1-en-2-yl]-3-imino-2-(1H-pyridin-2-ylidene)propanamide (PubChem CID 159166738) has the molecular formula C29H36ClF2N7O3 and a molecular weight of 604.10 g/mol. Its IUPAC name is (2E)-3-amino-N-[1-amino-1-[5-chloro-2-(difluoromethoxy)phenyl]-3-[1-(5-oxohexyl)piperidin-4-yl]iminoprop-1-en-2-yl]-3-imino-2-(1H-pyridin-2-ylidene)propanamide.
| Compound Name | (2E)-3-amino-N-[1-amino-1-[5-chloro-2-(difluoromethoxy)phenyl]-3-[1-(5-oxohexyl)piperidin-4-yl]iminoprop-1-en-2-yl]-3-imino-2-(1H-pyridin-2-ylidene)propanamide |
|---|---|
| PubChem CID | 159166738 |
| Molecular Formula | C29H36ClF2N7O3 |
| Molecular Weight | 604.10 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | (2E)-3-amino-N-[1-amino-1-[5-chloro-2-(difluoromethoxy)phenyl]-3-[1-(5-oxohexyl)piperidin-4-yl]iminoprop-1-en-2-yl]-3-imino-2-(1H-pyridin-2-ylidene)propanamide |
| SMILES | [H]/N=C(N)/C(C(=O)NC(/C=N/C1CCN(CCCCC(C)=O)CC1)=C(N)c1cc(Cl)ccc1OC(F)F)=C1/C=CC=CN1 |
| InChI | InChI=1S/C29H36ClF2N7O3/c1-18(40)6-3-5-13-39-14-10-20(11-15-39)37-17-23(26(33)21-16-19(30)8-9-24(21)42-29(31)32)38-28(41)25(27(34)35)22-7-2-4-12-36-22/h2,4,7-9,12,16-17,20,29,36H,3,5-6,10-11,13-15,33H2,1H3,(H3,34,35)(H,38,41)/b25-22+,26-23?,37-17+ |
| InChIKey | GUYCYJSPOWIHMG-YZXDICKLSA-N |
| XLogP | 3.84 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.10 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|