C26H24IrNO2S- — CID 159166986
5-(3,5-dimethylbenzene-6-id-1-yl)-2-phenylthieno[3,2-b]pyridine;4-hydroxypent-3-en-2-one;iridium (PubChem CID 159166986) has the molecular formula C26H24IrNO2S- and a molecular weight of 606.77 g/mol. Its IUPAC name is 5-(3,5-dimethylbenzene-6-id-1-yl)-2-phenylthieno[3,2-b]pyridine;4-hydroxypent-3-en-2-one;iridium.
| Compound Name | 5-(3,5-dimethylbenzene-6-id-1-yl)-2-phenylthieno[3,2-b]pyridine;4-hydroxypent-3-en-2-one;iridium |
|---|---|
| PubChem CID | 159166986 |
| Molecular Formula | C26H24IrNO2S- |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 607.12 |
| IUPAC Name | 5-(3,5-dimethylbenzene-6-id-1-yl)-2-phenylthieno[3,2-b]pyridine;4-hydroxypent-3-en-2-one;iridium |
| SMILES | CC(=O)C=C(C)O.Cc1[c-]c(-c2ccc3sc(-c4ccccc4)cc3n2)cc(C)c1.[Ir] |
| InChI | InChI=1S/C21H16NS.C5H8O2.Ir/c1-14-10-15(2)12-17(11-14)18-8-9-20-19(22-18)13-21(23-20)16-6-4-3-5-7-16;1-4(6)3-5(2)7;/h3-11,13H,1-2H3;3,6H,1-2H3;/q-1;; |
| InChIKey | BPJUWXKMGZWMCD-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|