About (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine
(2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine (PubChem CID 159167098) has the molecular formula C9H20N2O2S
and a molecular weight of 220.34 g/mol. Its IUPAC name is (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine.
Molecular Properties
| Compound Name | (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine |
| PubChem CID | 159167098 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine |
| SMILES | COC[C@@H](C)N.COC[C@@H](C)N=C=S |
| InChI | InChI=1S/C5H9NOS.C4H11NO/c1-5(3-7-2)6-4-8;1-4(5)3-6-2/h5H,3H2,1-2H3;4H,3,5H2,1-2H3/t5-;4-/m11/s1 |
| InChIKey | KLFBUAWKBQFUGN-ZYTCOCFOSA-N |
| XLogP | 1.10 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine?
The IUPAC name of (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine (CID 159167098) is (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine.
What is the SMILES notation for (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine?
The canonical SMILES for (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine is COC[C@@H](C)N.COC[C@@H](C)N=C=S.
What is the InChIKey of (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine?
The InChIKey is KLFBUAWKBQFUGN-ZYTCOCFOSA-N. The full InChI is InChI=1S/C5H9NOS.C4H11NO/c1-5(3-7-2)6-4-8;1-4(5)3-6-2/h5H,3H2,1-2H3;4H,3,5H2,1-2H3/t5-;4-/m11/s1.
What are the key properties of (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine?
(2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine has a molecular weight of 220.34 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-isothiocyanato-1-methoxypropane;(2R)-1-methoxypropan-2-amine is sourced from PubChem (CID 159167098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).