C31H20N4O5 — CID 159168432
5-[2-[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]-1,3-dioxoisoindol-5-yl]-2-methylisoindole-1,3-dione (PubChem CID 159168432) has the molecular formula C31H20N4O5 and a molecular weight of 528.52 g/mol. Its IUPAC name is 5-[2-[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]-1,3-dioxoisoindol-5-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]-1,3-dioxoisoindol-5-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 159168432 |
| Molecular Formula | C31H20N4O5 |
| Molecular Weight | 528.52 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | 5-[2-[4-hydroxy-3-(5-methyl-1H-benzimidazol-2-yl)phenyl]-1,3-dioxoisoindol-5-yl]-2-methylisoindole-1,3-dione |
| SMILES | Cc1ccc2[nH]c(-c3cc(N4C(=O)c5ccc(-c6ccc7c(c6)C(=O)N(C)C7=O)cc5C4=O)ccc3O)nc2c1 |
| InChI | InChI=1S/C31H20N4O5/c1-15-3-9-24-25(11-15)33-27(32-24)23-14-18(6-10-26(23)36)35-30(39)20-8-5-17(13-22(20)31(35)40)16-4-7-19-21(12-16)29(38)34(2)28(19)37/h3-14,36H,1-2H3,(H,32,33) |
| InChIKey | PJOOKIFTXCQJBZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|