C36H68N4O6 — CID 159168644
tert-butyl N-[1-(4-ethoxycyclohexyl)piperidin-4-yl]carbamate (PubChem CID 159168644) has the molecular formula C36H68N4O6 and a molecular weight of 652.96 g/mol. Its IUPAC name is tert-butyl N-[1-(4-ethoxycyclohexyl)piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(4-ethoxycyclohexyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 159168644 |
| Molecular Formula | C36H68N4O6 |
| Molecular Weight | 652.96 g/mol |
| Exact Mass | 652.51 |
| IUPAC Name | tert-butyl N-[1-(4-ethoxycyclohexyl)piperidin-4-yl]carbamate |
| SMILES | CCOC1CCC(N2CCC(NC(=O)OC(C)(C)C)CC2)CC1.CCOC1CCC(N2CCC(NC(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/2C18H34N2O3/c2*1-5-22-16-8-6-15(7-9-16)20-12-10-14(11-13-20)19-17(21)23-18(2,3)4/h2*14-16H,5-13H2,1-4H3,(H,19,21) |
| InChIKey | KLKAHJBRAUTAMJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.96 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |