C38H36O10 — CID 159169687
6-methoxy-4,5-dimethyl-14,16-dioxatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2(7),3,5,11,13(17)-hexaen-10-one;1-[6-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one (PubChem CID 159169687) has the molecular formula C38H36O10 and a molecular weight of 652.70 g/mol. Its IUPAC name is 6-methoxy-4,5-dimethyl-14,16-dioxatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2(7),3,5,11,13(17)-hexaen-10-one;1-[6-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one.
| Compound Name | 6-methoxy-4,5-dimethyl-14,16-dioxatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2(7),3,5,11,13(17)-hexaen-10-one;1-[6-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 159169687 |
| Molecular Formula | C38H36O10 |
| Molecular Weight | 652.70 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | 6-methoxy-4,5-dimethyl-14,16-dioxatetracyclo[9.7.0.02,7.013,17]octadeca-1(18),2(7),3,5,11,13(17)-hexaen-10-one;1-[6-(3,4,5-trimethoxyphenyl)-1,3-benzodioxol-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1cc2c(cc1-c1cc(OC)c(OC)c(OC)c1)OCO2.COc1c(C)c(C)cc2c1CCC(=O)c1cc3c(cc1-2)OCO3 |
| InChI | InChI=1S/C19H18O6.C19H18O4/c1-5-14(20)13-9-16-15(24-10-25-16)8-12(13)11-6-17(21-2)19(23-4)18(7-11)22-3;1-10-6-13-12(19(21-3)11(10)2)4-5-16(20)15-8-18-17(7-14(13)15)22-9-23-18/h5-9H,1,10H2,2-4H3;6-8H,4-5,9H2,1-3H3 |
| InChIKey | KLNGLMWDMBMDGQ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.70 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|