C8H7Cl4N8O2S- — CID 159170791
2-[[4-chloro-6-(deuterioamino)-1,3,5-triazin-2-yl]sulfanyl]acetic acid;4,6-dichloro-N-deuterio-1,3,5-triazin-2-amine;chloride (PubChem CID 159170791) has the molecular formula C8H7Cl4N8O2S- and a molecular weight of 423.09 g/mol. Its IUPAC name is 2-[[4-chloro-6-(deuterioamino)-1,3,5-triazin-2-yl]sulfanyl]acetic acid;4,6-dichloro-N-deuterio-1,3,5-triazin-2-amine;chloride.
| Compound Name | 2-[[4-chloro-6-(deuterioamino)-1,3,5-triazin-2-yl]sulfanyl]acetic acid;4,6-dichloro-N-deuterio-1,3,5-triazin-2-amine;chloride |
|---|---|
| PubChem CID | 159170791 |
| Molecular Formula | C8H7Cl4N8O2S- |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 2-[[4-chloro-6-(deuterioamino)-1,3,5-triazin-2-yl]sulfanyl]acetic acid;4,6-dichloro-N-deuterio-1,3,5-triazin-2-amine;chloride |
| SMILES | [2H]Nc1nc(Cl)nc(Cl)n1.[2H]Nc1nc(Cl)nc(SCC(=O)O)n1.[Cl-] |
| InChI | InChI=1S/C5H5ClN4O2S.C3H2Cl2N4.ClH/c6-3-8-4(7)10-5(9-3)13-1-2(11)12;4-1-7-2(5)9-3(6)8-1;/h1H2,(H,11,12)(H2,7,8,9,10);(H2,6,7,8,9);1H/p-1/i/hD2 |
| InChIKey | LDODOYLOWCGEPT-ZSJDYOACSA-M |
| XLogP | -1.95 |
| TPSA | 166.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |