C18H17Cl3N4 — CID 159171730
5-chloro-2-[(3S)-3-[2-(3,5-dichlorophenyl)ethyl]pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridine (PubChem CID 159171730) has the molecular formula C18H17Cl3N4 and a molecular weight of 395.72 g/mol. Its IUPAC name is 5-chloro-2-[(3S)-3-[2-(3,5-dichlorophenyl)ethyl]pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-[(3S)-3-[2-(3,5-dichlorophenyl)ethyl]pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 159171730 |
| Molecular Formula | C18H17Cl3N4 |
| Molecular Weight | 395.72 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 5-chloro-2-[(3S)-3-[2-(3,5-dichlorophenyl)ethyl]pyrrolidin-1-yl]-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc(Cl)cc(CC[C@H]2CCN(c3nc4nc(Cl)ccc4[nH]3)C2)c1 |
| InChI | InChI=1S/C18H17Cl3N4/c19-13-7-12(8-14(20)9-13)2-1-11-5-6-25(10-11)18-22-15-3-4-16(21)23-17(15)24-18/h3-4,7-9,11H,1-2,5-6,10H2,(H,22,23,24)/t11-/m0/s1 |
| InChIKey | KLTSJYQTRFWDLE-NSHDSACASA-N |
| XLogP | 5.38 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.72 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|