C46H28F2N6O2 — CID 159172326
3-[1-(2-fluorophenyl)imidazo[4,5-c]quinolin-8-yl]benzaldehyde (PubChem CID 159172326) has the molecular formula C46H28F2N6O2 and a molecular weight of 734.77 g/mol. Its IUPAC name is 3-[1-(2-fluorophenyl)imidazo[4,5-c]quinolin-8-yl]benzaldehyde.
| Compound Name | 3-[1-(2-fluorophenyl)imidazo[4,5-c]quinolin-8-yl]benzaldehyde |
|---|---|
| PubChem CID | 159172326 |
| Molecular Formula | C46H28F2N6O2 |
| Molecular Weight | 734.77 g/mol |
| Exact Mass | 734.22 |
| IUPAC Name | 3-[1-(2-fluorophenyl)imidazo[4,5-c]quinolin-8-yl]benzaldehyde |
| SMILES | O=Cc1cccc(-c2ccc3ncc4ncn(-c5ccccc5F)c4c3c2)c1.O=Cc1cccc(-c2ccc3ncc4ncn(-c5ccccc5F)c4c3c2)c1 |
| InChI | InChI=1S/2C23H14FN3O/c2*24-19-6-1-2-7-22(19)27-14-26-21-12-25-20-9-8-17(11-18(20)23(21)27)16-5-3-4-15(10-16)13-28/h2*1-14H |
| InChIKey | KLVRCPSSKBPEDO-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 95.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.77 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|