C20H21FN4O2S2 — CID 159172359
(3S)-3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine (PubChem CID 159172359) has the molecular formula C20H21FN4O2S2 and a molecular weight of 432.55 g/mol. Its IUPAC name is (3S)-3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3S)-3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 159172359 |
| Molecular Formula | C20H21FN4O2S2 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | (3S)-3-[3-fluoro-5-[3-(1,3,4-oxadiazol-2-yl)phenyl]thiophen-2-yl]-3,6,6-trimethyl-1-methylidene-1-oxo-2H-1,4-thiazin-5-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc(-c3cccc(-c4nnco4)c3)cc2F)N=C(N)C1(C)C |
| InChI | InChI=1S/C20H21FN4O2S2/c1-19(2)18(22)24-20(3,10-29(19,4)26)16-14(21)9-15(28-16)12-6-5-7-13(8-12)17-25-23-11-27-17/h5-9,11H,4,10H2,1-3H3,(H2,22,24)/t20-,29?/m0/s1 |
| InChIKey | DSSVEFCBRWLHSC-OORIHMLWSA-N |
| XLogP | 3.69 |
| TPSA | 94.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|