C21H18N8OS — CID 159173110
1-[4-(3-isocyano-1,2,4-thiadiazol-5-yl)-1-methylpyrazol-5-yl]-2-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)ethanone (PubChem CID 159173110) has the molecular formula C21H18N8OS and a molecular weight of 430.50 g/mol. Its IUPAC name is 1-[4-(3-isocyano-1,2,4-thiadiazol-5-yl)-1-methylpyrazol-5-yl]-2-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)ethanone.
| Compound Name | 1-[4-(3-isocyano-1,2,4-thiadiazol-5-yl)-1-methylpyrazol-5-yl]-2-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)ethanone |
|---|---|
| PubChem CID | 159173110 |
| Molecular Formula | C21H18N8OS |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[4-(3-isocyano-1,2,4-thiadiazol-5-yl)-1-methylpyrazol-5-yl]-2-(2-phenyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-7-yl)ethanone |
| SMILES | [C-]#[N+]c1nsc(-c2cnn(C)c2C(=O)CC2CCn3nc(-c4ccccc4)nc3C2)n1 |
| InChI | InChI=1S/C21H18N8OS/c1-22-21-25-20(31-27-21)15-12-23-28(2)18(15)16(30)10-13-8-9-29-17(11-13)24-19(26-29)14-6-4-3-5-7-14/h3-7,12-13H,8-11H2,2H3 |
| InChIKey | FXXWZRLDUJOHOI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|