C30H42N2O6 — CID 159173410
methyl 8-(4-aminophenyl)octanoate;methyl (E)-8-(4-nitrophenyl)oct-7-enoate (PubChem CID 159173410) has the molecular formula C30H42N2O6 and a molecular weight of 526.67 g/mol. Its IUPAC name is methyl 8-(4-aminophenyl)octanoate;methyl (E)-8-(4-nitrophenyl)oct-7-enoate.
| Compound Name | methyl 8-(4-aminophenyl)octanoate;methyl (E)-8-(4-nitrophenyl)oct-7-enoate |
|---|---|
| PubChem CID | 159173410 |
| Molecular Formula | C30H42N2O6 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | methyl 8-(4-aminophenyl)octanoate;methyl (E)-8-(4-nitrophenyl)oct-7-enoate |
| SMILES | COC(=O)CCCCC/C=C/c1ccc([N+](=O)[O-])cc1.COC(=O)CCCCCCCc1ccc(N)cc1 |
| InChI | InChI=1S/C15H19NO4.C15H23NO2/c1-20-15(17)8-6-4-2-3-5-7-13-9-11-14(12-10-13)16(18)19;1-18-15(17)8-6-4-2-3-5-7-13-9-11-14(16)12-10-13/h5,7,9-12H,2-4,6,8H2,1H3;9-12H,2-8,16H2,1H3/b7-5+; |
| InChIKey | KLYZCMJPRWAOQN-GZOLSCHFSA-N |
| XLogP | 7.06 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|