C17H21N3O — CID 159173812
2-[2-(oxan-2-yl)pyrazol-3-yl]-5,6,7,8-tetrahydroquinoline (PubChem CID 159173812) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-[2-(oxan-2-yl)pyrazol-3-yl]-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-[2-(oxan-2-yl)pyrazol-3-yl]-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 159173812 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 2-[2-(oxan-2-yl)pyrazol-3-yl]-5,6,7,8-tetrahydroquinoline |
| SMILES | c1cc(-c2ccc3c(n2)CCCC3)n(C2CCCCO2)n1 |
| InChI | InChI=1S/C17H21N3O/c1-2-6-14-13(5-1)8-9-15(19-14)16-10-11-18-20(16)17-7-3-4-12-21-17/h8-11,17H,1-7,12H2 |
| InChIKey | UXEACNBFCCPZBQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |