C26H22FN3OSi — CID 159173887
2-[6-(2-fluorophenyl)-3-(furan-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane (PubChem CID 159173887) has the molecular formula C26H22FN3OSi and a molecular weight of 439.57 g/mol. Its IUPAC name is 2-[6-(2-fluorophenyl)-3-(furan-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[6-(2-fluorophenyl)-3-(furan-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 159173887 |
| Molecular Formula | C26H22FN3OSi |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[6-(2-fluorophenyl)-3-(furan-2-yl)-4H-imidazo[1,5-a][1,4]benzodiazepin-8-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#Cc1ccc2c(c1)C(c1ccccc1F)=NCc1c(-c3ccco3)ncn1-2 |
| InChI | InChI=1S/C26H22FN3OSi/c1-32(2,3)14-12-18-10-11-22-20(15-18)25(19-7-4-5-8-21(19)27)28-16-23-26(29-17-30(22)23)24-9-6-13-31-24/h4-11,13,15,17H,16H2,1-3H3 |
| InChIKey | OBELFKINPXUTNM-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 43.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|