About N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine
N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine (PubChem CID 159174464) has the molecular formula C21H23F3N2S
and a molecular weight of 392.49 g/mol. Its IUPAC name is N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine.
Molecular Properties
| Compound Name | N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine |
| PubChem CID | 159174464 |
| Molecular Formula | C21H23F3N2S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine |
| SMILES | N[C@@H]1CCC[C@@H](CNc2cc(C(F)(F)F)cc3c2Cc2ccccc2S3)C1 |
| InChI | InChI=1S/C21H23F3N2S/c22-21(23,24)15-10-18(26-12-13-4-3-6-16(25)8-13)17-9-14-5-1-2-7-19(14)27-20(17)11-15/h1-2,5,7,10-11,13,16,26H,3-4,6,8-9,12,25H2/t13-,16-/m1/s1 |
| InChIKey | KMCHZLWJQYUODA-CZUORRHYSA-N |
| XLogP | 5.69 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine?
The IUPAC name of N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine (CID 159174464) is N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine.
What is the SMILES notation for N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine?
The canonical SMILES for N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine is N[C@@H]1CCC[C@@H](CNc2cc(C(F)(F)F)cc3c2Cc2ccccc2S3)C1.
What is the InChIKey of N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine?
The InChIKey is KMCHZLWJQYUODA-CZUORRHYSA-N. The full InChI is InChI=1S/C21H23F3N2S/c22-21(23,24)15-10-18(26-12-13-4-3-6-16(25)8-13)17-9-14-5-1-2-7-19(14)27-20(17)11-15/h1-2,5,7,10-11,13,16,26H,3-4,6,8-9,12,25H2/t13-,16-/m1/s1.
What are the key properties of N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine?
N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine has a molecular weight of 392.49 g/mol, XLogP of 5.69, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,3R)-3-aminocyclohexyl]methyl]-3-(trifluoromethyl)-9H-thioxanthen-1-amine is sourced from PubChem (CID 159174464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).