About dimethoxy(methyl)silane;methylimino(oxo)methane
dimethoxy(methyl)silane;methylimino(oxo)methane (PubChem CID 159174466) has the molecular formula C5H13NO3Si
and a molecular weight of 163.25 g/mol. Its IUPAC name is dimethoxy(methyl)silane;methylimino(oxo)methane.
Molecular Properties
| Compound Name | dimethoxy(methyl)silane;methylimino(oxo)methane |
| PubChem CID | 159174466 |
| Molecular Formula | C5H13NO3Si |
| Molecular Weight | 163.25 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | dimethoxy(methyl)silane;methylimino(oxo)methane |
| SMILES | CN=C=O.CO[SiH](C)OC |
| InChI | InChI=1S/C3H10O2Si.C2H3NO/c1-4-6(3)5-2;1-3-2-4/h6H,1-3H3;1H3 |
| InChIKey | KMCIBZNYNRTIGS-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze dimethoxy(methyl)silane;methylimino(oxo)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxy(methyl)silane;methylimino(oxo)methane?
The IUPAC name of dimethoxy(methyl)silane;methylimino(oxo)methane (CID 159174466) is dimethoxy(methyl)silane;methylimino(oxo)methane.
What is the SMILES notation for dimethoxy(methyl)silane;methylimino(oxo)methane?
The canonical SMILES for dimethoxy(methyl)silane;methylimino(oxo)methane is CN=C=O.CO[SiH](C)OC.
What is the InChIKey of dimethoxy(methyl)silane;methylimino(oxo)methane?
The InChIKey is KMCIBZNYNRTIGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10O2Si.C2H3NO/c1-4-6(3)5-2;1-3-2-4/h6H,1-3H3;1H3.
What are the key properties of dimethoxy(methyl)silane;methylimino(oxo)methane?
dimethoxy(methyl)silane;methylimino(oxo)methane has a molecular weight of 163.25 g/mol, XLogP of 0.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxy(methyl)silane;methylimino(oxo)methane is sourced from PubChem (CID 159174466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).