About oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran]
oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] (PubChem CID 15917464) has the molecular formula C21H19NO5
and a molecular weight of 365.39 g/mol. Its IUPAC name is oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran].
Molecular Properties
| Compound Name | oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] |
| PubChem CID | 15917464 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] |
| SMILES | C#CCN1Cc2ccccc2C2(Cc3ccccc3O2)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H17NO.C2H2O4/c1-2-11-20-13-16-8-3-5-9-17(16)19(14-20)12-15-7-4-6-10-18(15)21-19;3-1(4)2(5)6/h1,3-10H,11-14H2;(H,3,4)(H,5,6) |
| InChIKey | QHVBIXSEPIFLJK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran]?
The IUPAC name of oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] (CID 15917464) is oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran].
What is the SMILES notation for oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran]?
The canonical SMILES for oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] is C#CCN1Cc2ccccc2C2(Cc3ccccc3O2)C1.O=C(O)C(=O)O.
What is the InChIKey of oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran]?
The InChIKey is QHVBIXSEPIFLJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO.C2H2O4/c1-2-11-20-13-16-8-3-5-9-17(16)19(14-20)12-15-7-4-6-10-18(15)21-19;3-1(4)2(5)6/h1,3-10H,11-14H2;(H,3,4)(H,5,6).
What are the key properties of oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran]?
oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] has a molecular weight of 365.39 g/mol, XLogP of 2.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxalic acid;2-prop-2-ynylspiro[1,3-dihydroisoquinoline-4,2'-3H-1-benzofuran] is sourced from PubChem (CID 15917464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).