About 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine
4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine (PubChem CID 159175096) has the molecular formula C20H25N3O4S
and a molecular weight of 403.50 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 159175096 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.Nc1c(CC2CCOCC2)nn2ccccc12 |
| InChI | InChI=1S/C13H17N3O.C7H8O3S/c14-13-11(9-10-4-7-17-8-5-10)15-16-6-2-1-3-12(13)16;1-6-2-4-7(5-3-6)11(8,9)10/h1-3,6,10H,4-5,7-9,14H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | KMEHHMZSKVBFHI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine (CID 159175096) is 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine is Cc1ccc(S(=O)(=O)O)cc1.Nc1c(CC2CCOCC2)nn2ccccc12.
What is the InChIKey of 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is KMEHHMZSKVBFHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O.C7H8O3S/c14-13-11(9-10-4-7-17-8-5-10)15-16-6-2-1-3-12(13)16;1-6-2-4-7(5-3-6)11(8,9)10/h1-3,6,10H,4-5,7-9,14H2;2-5H,1H3,(H,8,9,10).
What are the key properties of 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine?
4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 403.50 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenesulfonic acid;2-(oxan-4-ylmethyl)pyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 159175096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).