C26H28Br2N4OSi — CID 159175171
3-bromo-5-isocyano-1H-indole;2-(3-bromo-5-isocyanoindol-1-yl)ethoxy-tert-butyl-dimethylsilane (PubChem CID 159175171) has the molecular formula C26H28Br2N4OSi and a molecular weight of 600.43 g/mol. Its IUPAC name is 3-bromo-5-isocyano-1H-indole;2-(3-bromo-5-isocyanoindol-1-yl)ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-bromo-5-isocyano-1H-indole;2-(3-bromo-5-isocyanoindol-1-yl)ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 159175171 |
| Molecular Formula | C26H28Br2N4OSi |
| Molecular Weight | 600.43 g/mol |
| Exact Mass | 598.04 |
| IUPAC Name | 3-bromo-5-isocyano-1H-indole;2-(3-bromo-5-isocyanoindol-1-yl)ethoxy-tert-butyl-dimethylsilane |
| SMILES | [C-]#[N+]c1ccc2[nH]cc(Br)c2c1.[C-]#[N+]c1ccc2c(c1)c(Br)cn2CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H23BrN2OSi.C9H5BrN2/c1-17(2,3)22(5,6)21-10-9-20-12-15(18)14-11-13(19-4)7-8-16(14)20;1-11-6-2-3-9-7(4-6)8(10)5-12-9/h7-8,11-12H,9-10H2,1-3,5-6H3;2-5,12H |
| InChIKey | KMEMFAJHXBIPIF-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 38.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.43 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|