About potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide
potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide (PubChem CID 159175349) has the molecular formula C5H6F5KNO4S2+
and a molecular weight of 342.33 g/mol. Its IUPAC name is potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide.
Molecular Properties
| Compound Name | potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide |
| PubChem CID | 159175349 |
| Molecular Formula | C5H6F5KNO4S2+ |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 341.93 |
| IUPAC Name | potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)N=S(=O)(OC(F)F)C(F)(F)F.[K+] |
| InChI | InChI=1S/C5H6F5NO4S2.K/c1-2-3-16(12,13)11-17(14,5(8,9)10)15-4(6)7;/h2,4H,1,3H2;/q;+1 |
| InChIKey | KXPLMVDKZMFVJW-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
The IUPAC name of potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide (CID 159175349) is potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide.
What is the SMILES notation for potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
The canonical SMILES for potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide is C=CCS(=O)(=O)N=S(=O)(OC(F)F)C(F)(F)F.[K+].
What is the InChIKey of potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
The InChIKey is KXPLMVDKZMFVJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F5NO4S2.K/c1-2-3-16(12,13)11-17(14,5(8,9)10)15-4(6)7;/h2,4H,1,3H2;/q;+1.
What are the key properties of potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide?
potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide has a molecular weight of 342.33 g/mol, XLogP of -1.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium N-[difluoromethoxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]prop-2-ene-1-sulfonamide is sourced from PubChem (CID 159175349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).