About 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate
2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate (PubChem CID 15917554) has the molecular formula C6H5Cl3N2O2
and a molecular weight of 243.48 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate |
| PubChem CID | 15917554 |
| Molecular Formula | C6H5Cl3N2O2 |
| Molecular Weight | 243.48 g/mol |
| Exact Mass | 241.94 |
| IUPAC Name | 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate |
| SMILES | N#CC1CN1C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H5Cl3N2O2/c7-6(8,9)3-13-5(12)11-2-4(11)1-10/h4H,2-3H2 |
| InChIKey | VLKXQJULLQQEDH-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate?
The IUPAC name of 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate (CID 15917554) is 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate.
What is the SMILES notation for 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate?
The canonical SMILES for 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate is N#CC1CN1C(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate?
The InChIKey is VLKXQJULLQQEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl3N2O2/c7-6(8,9)3-13-5(12)11-2-4(11)1-10/h4H,2-3H2.
What are the key properties of 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate?
2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate has a molecular weight of 243.48 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl 2-cyanoaziridine-1-carboxylate is sourced from PubChem (CID 15917554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).