C20H40O2 — CID 15917605
[(2R,3R)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]methanol (PubChem CID 15917605) has the molecular formula C20H40O2 and a molecular weight of 312.54 g/mol. Its IUPAC name is [(2R,3R)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 15917605 |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.54 g/mol |
| Exact Mass | 312.30 |
| IUPAC Name | [(2R,3R)-3-methyl-3-[(4R,8R)-4,8,12-trimethyltridecyl]oxiran-2-yl]methanol |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@]1(C)O[C@@H]1CO |
| InChI | InChI=1S/C20H40O2/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20(5)19(15-21)22-20/h16-19,21H,6-15H2,1-5H3/t17-,18-,19-,20-/m1/s1 |
| InChIKey | DSWPRMYGLZQURA-UAFMIMERSA-N |
| XLogP | 5.58 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.54 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|