C18H23N3O2 — CID 15917643
1-[2-(1-imidazol-1-ylethenyl)phenoxy]-3-pyrrolidin-1-ylpropan-2-ol (PubChem CID 15917643) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[2-(1-imidazol-1-ylethenyl)phenoxy]-3-pyrrolidin-1-ylpropan-2-ol.
| Compound Name | 1-[2-(1-imidazol-1-ylethenyl)phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 15917643 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[2-(1-imidazol-1-ylethenyl)phenoxy]-3-pyrrolidin-1-ylpropan-2-ol |
| SMILES | C=C(c1ccccc1OCC(O)CN1CCCC1)n1ccnc1 |
| InChI | InChI=1S/C18H23N3O2/c1-15(21-11-8-19-14-21)17-6-2-3-7-18(17)23-13-16(22)12-20-9-4-5-10-20/h2-3,6-8,11,14,16,22H,1,4-5,9-10,12-13H2 |
| InChIKey | LKTXWODSKCMTEQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |