C22H42N2O6 — CID 159176548
tert-butyl 3-ethoxypiperidine-1-carboxylate;tert-butyl 3-hydroxypiperidine-1-carboxylate (PubChem CID 159176548) has the molecular formula C22H42N2O6 and a molecular weight of 430.59 g/mol. Its IUPAC name is tert-butyl 3-ethoxypiperidine-1-carboxylate;tert-butyl 3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-ethoxypiperidine-1-carboxylate;tert-butyl 3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 159176548 |
| Molecular Formula | C22H42N2O6 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | tert-butyl 3-ethoxypiperidine-1-carboxylate;tert-butyl 3-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)C1.CCOC1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H23NO3.C10H19NO3/c1-5-15-10-7-6-8-13(9-10)11(14)16-12(2,3)4;1-10(2,3)14-9(13)11-6-4-5-8(12)7-11/h10H,5-9H2,1-4H3;8,12H,4-7H2,1-3H3 |
| InChIKey | KMIURDUKXPNKAZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |