C23H31Cl2F3N4O2 — CID 159178200
3-N-decyl-2-N-methyl-5-(trifluoromethyl)pyridine-2,3-diamine;3,6-dichloropyridine-2-carboxylic acid (PubChem CID 159178200) has the molecular formula C23H31Cl2F3N4O2 and a molecular weight of 523.43 g/mol. Its IUPAC name is 3-N-decyl-2-N-methyl-5-(trifluoromethyl)pyridine-2,3-diamine;3,6-dichloropyridine-2-carboxylic acid.
| Compound Name | 3-N-decyl-2-N-methyl-5-(trifluoromethyl)pyridine-2,3-diamine;3,6-dichloropyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 159178200 |
| Molecular Formula | C23H31Cl2F3N4O2 |
| Molecular Weight | 523.43 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | 3-N-decyl-2-N-methyl-5-(trifluoromethyl)pyridine-2,3-diamine;3,6-dichloropyridine-2-carboxylic acid |
| SMILES | CCCCCCCCCCNc1cc(C(F)(F)F)cnc1NC.O=C(O)c1nc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H28F3N3.C6H3Cl2NO2/c1-3-4-5-6-7-8-9-10-11-22-15-12-14(17(18,19)20)13-23-16(15)21-2;7-3-1-2-4(8)9-5(3)6(10)11/h12-13,22H,3-11H2,1-2H3,(H,21,23);1-2H,(H,10,11) |
| InChIKey | KMNYTOCPINSNBK-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.43 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|