About 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one
1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one (PubChem CID 159178545) has the molecular formula C20H41N3O3
and a molecular weight of 371.57 g/mol. Its IUPAC name is 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one.
Molecular Properties
| Compound Name | 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one |
| PubChem CID | 159178545 |
| Molecular Formula | C20H41N3O3 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.31 |
| IUPAC Name | 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one |
| SMILES | CC(=O)CNC1CC1.CCCCCNCC(C)=O.CCCNCC(C)=O |
| InChI | InChI=1S/C8H17NO.C6H11NO.C6H13NO/c1-3-4-5-6-9-7-8(2)10;1-5(8)4-7-6-2-3-6;1-3-4-7-5-6(2)8/h9H,3-7H2,1-2H3;6-7H,2-4H2,1H3;7H,3-5H2,1-2H3 |
| InChIKey | KMOYJHPZOYHADA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one?
The IUPAC name of 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one (CID 159178545) is 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one.
What is the SMILES notation for 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one?
The canonical SMILES for 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one is CC(=O)CNC1CC1.CCCCCNCC(C)=O.CCCNCC(C)=O.
What is the InChIKey of 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one?
The InChIKey is KMOYJHPZOYHADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.C6H11NO.C6H13NO/c1-3-4-5-6-9-7-8(2)10;1-5(8)4-7-6-2-3-6;1-3-4-7-5-6(2)8/h9H,3-7H2,1-2H3;6-7H,2-4H2,1H3;7H,3-5H2,1-2H3.
What are the key properties of 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one?
1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one has a molecular weight of 371.57 g/mol, XLogP of 2.26, 13 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylamino)propan-2-one;1-(pentylamino)propan-2-one;1-(propylamino)propan-2-one is sourced from PubChem (CID 159178545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).