C26H29F3N4O2 — CID 159180095
1-benzyl-3-methylpyrazole-4-carbaldehyde;1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol;methane (PubChem CID 159180095) has the molecular formula C26H29F3N4O2 and a molecular weight of 486.54 g/mol. Its IUPAC name is 1-benzyl-3-methylpyrazole-4-carbaldehyde;1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol;methane.
| Compound Name | 1-benzyl-3-methylpyrazole-4-carbaldehyde;1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol;methane |
|---|---|
| PubChem CID | 159180095 |
| Molecular Formula | C26H29F3N4O2 |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 1-benzyl-3-methylpyrazole-4-carbaldehyde;1-(1-benzyl-3-methylpyrazol-4-yl)-2,2,2-trifluoroethanol;methane |
| SMILES | C.Cc1nn(Cc2ccccc2)cc1C(O)C(F)(F)F.Cc1nn(Cc2ccccc2)cc1C=O |
| InChI | InChI=1S/C13H13F3N2O.C12H12N2O.CH4/c1-9-11(12(19)13(14,15)16)8-18(17-9)7-10-5-3-2-4-6-10;1-10-12(9-15)8-14(13-10)7-11-5-3-2-4-6-11;/h2-6,8,12,19H,7H2,1H3;2-6,8-9H,7H2,1H3;1H4 |
| InChIKey | KMTWAFAAJPSITO-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|