About dec-5-ynyl acetate
dec-5-ynyl acetate (PubChem CID 15918016) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is dec-5-ynyl acetate.
Molecular Properties
| Compound Name | dec-5-ynyl acetate |
| PubChem CID | 15918016 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | dec-5-ynyl acetate |
| SMILES | CCCCC#CCCCCOC(C)=O |
| InChI | InChI=1S/C12H20O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-5,8-11H2,1-2H3 |
| InChIKey | KGRCAMKVYBXORP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze dec-5-ynyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-5-ynyl acetate?
The IUPAC name of dec-5-ynyl acetate (CID 15918016) is dec-5-ynyl acetate.
What is the SMILES notation for dec-5-ynyl acetate?
The canonical SMILES for dec-5-ynyl acetate is CCCCC#CCCCCOC(C)=O.
What is the InChIKey of dec-5-ynyl acetate?
The InChIKey is KGRCAMKVYBXORP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-3-4-5-6-7-8-9-10-11-14-12(2)13/h3-5,8-11H2,1-2H3.
What are the key properties of dec-5-ynyl acetate?
dec-5-ynyl acetate has a molecular weight of 196.29 g/mol, XLogP of 2.91, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dec-5-ynyl acetate is sourced from PubChem (CID 15918016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).