C34H43N5O4 — CID 159181542
6-tert-butyl-3H-1,3-benzoxazol-2-one;5-tert-butyl-1,3-dihydrobenzimidazol-2-one;5-tert-butyl-2-methyl-1H-indazol-3-one (PubChem CID 159181542) has the molecular formula C34H43N5O4 and a molecular weight of 585.75 g/mol. Its IUPAC name is 6-tert-butyl-3H-1,3-benzoxazol-2-one;5-tert-butyl-1,3-dihydrobenzimidazol-2-one;5-tert-butyl-2-methyl-1H-indazol-3-one.
| Compound Name | 6-tert-butyl-3H-1,3-benzoxazol-2-one;5-tert-butyl-1,3-dihydrobenzimidazol-2-one;5-tert-butyl-2-methyl-1H-indazol-3-one |
|---|---|
| PubChem CID | 159181542 |
| Molecular Formula | C34H43N5O4 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | 6-tert-butyl-3H-1,3-benzoxazol-2-one;5-tert-butyl-1,3-dihydrobenzimidazol-2-one;5-tert-butyl-2-methyl-1H-indazol-3-one |
| SMILES | CC(C)(C)c1ccc2[nH]c(=O)[nH]c2c1.CC(C)(C)c1ccc2[nH]c(=O)oc2c1.Cn1[nH]c2ccc(C(C)(C)C)cc2c1=O |
| InChI | InChI=1S/C12H16N2O.C11H14N2O.C11H13NO2/c1-12(2,3)8-5-6-10-9(7-8)11(15)14(4)13-10;1-11(2,3)7-4-5-8-9(6-7)13-10(14)12-8;1-11(2,3)7-4-5-8-9(6-7)14-10(13)12-8/h5-7,13H,1-4H3;4-6H,1-3H3,(H2,12,13,14);4-6H,1-3H3,(H,12,13) |
| InChIKey | KMYMHBIZQZEJKR-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|