C45H52N2O7S3 — CID 159184599
2-[[4-(N-butyl-4-propylsulfonylanilino)phenyl]-[4-[butyl-(4-propylsulfonylphenyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonate (PubChem CID 159184599) has the molecular formula C45H52N2O7S3 and a molecular weight of 829.12 g/mol. Its IUPAC name is 2-[[4-(N-butyl-4-propylsulfonylanilino)phenyl]-[4-[butyl-(4-propylsulfonylphenyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonate.
| Compound Name | 2-[[4-(N-butyl-4-propylsulfonylanilino)phenyl]-[4-[butyl-(4-propylsulfonylphenyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 159184599 |
| Molecular Formula | C45H52N2O7S3 |
| Molecular Weight | 829.12 g/mol |
| Exact Mass | 828.29 |
| IUPAC Name | 2-[[4-(N-butyl-4-propylsulfonylanilino)phenyl]-[4-[butyl-(4-propylsulfonylphenyl)azaniumylidene]cyclohexa-2,5-dien-1-ylidene]methyl]benzenesulfonate |
| SMILES | CCCCN(c1ccc(C(=C2C=CC(=[N+](CCCC)c3ccc(S(=O)(=O)CCC)cc3)C=C2)c2ccccc2S(=O)(=O)[O-])cc1)c1ccc(S(=O)(=O)CCC)cc1 |
| InChI | InChI=1S/C45H52N2O7S3/c1-5-9-31-46(39-23-27-41(28-24-39)55(48,49)33-7-3)37-19-15-35(16-20-37)45(43-13-11-12-14-44(43)57(52,53)54)36-17-21-38(22-18-36)47(32-10-6-2)40-25-29-42(30-26-40)56(50,51)34-8-4/h11-30H,5-10,31-34H2,1-4H3 |
| InChIKey | KNIBHFPOULRIHA-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 131.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.12 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|